C22H24N4O3 — CID 165422992
(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(5-methyl-1,2,4-oxadiazol-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 165422992) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is (1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(5-methyl-1,2,4-oxadiazol-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(5-methyl-1,2,4-oxadiazol-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 165422992 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(5-methyl-1,2,4-oxadiazol-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4noc(C)n4)C3)c3cccc(=O)n32)c1 |
| InChI | InChI=1S/C22H24N4O3/c1-14-23-22(24-29-14)25-12-16-11-17(13-25)20(26-19(16)7-4-8-21(26)27)10-15-5-3-6-18(9-15)28-2/h3-9,16-17,20H,10-13H2,1-2H3/t16-,17+,20+/m1/s1 |
| InChIKey | OYUFBBKGXLYNDL-UWVAXJGDSA-N |
| XLogP | 2.96 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |