C25H24N4O2 — CID 164692122
2-[(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile (PubChem CID 164692122) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164692122 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4ncccc4C#N)C3)c3cccc(=O)n32)c1 |
| InChI | InChI=1S/C25H24N4O2/c1-31-21-7-2-5-17(11-21)12-23-20-13-19(22-8-3-9-24(30)29(22)23)15-28(16-20)25-18(14-26)6-4-10-27-25/h2-11,19-20,23H,12-13,15-16H2,1H3/t19-,20+,23+/m1/s1 |
| InChIKey | INTLJWDXQUZOSL-QTEQDKRBSA-N |
| XLogP | 3.53 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |