C22H26N4O — CID 164691733
2-[(1R,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile (PubChem CID 164691733) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[(1R,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[(1R,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164691733 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[(1R,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pyridine-3-carbonitrile |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(c3ncccc3C#N)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C22H26N4O/c1-15(2)8-9-20-18-11-17(19-6-3-7-21(27)26(19)20)13-25(14-18)22-16(12-23)5-4-10-24-22/h3-7,10,15,17-18,20H,8-9,11,13-14H2,1-2H3/t17-,18+,20+/m1/s1 |
| InChIKey | JEFLGYAYGZJOPT-HBFSDRIKSA-N |
| XLogP | 3.72 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |