C20H27N5O — CID 169416355
(1R,8R,9S)-11-[(2-amino-3-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 169416355) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is (1R,8R,9S)-11-[(2-amino-3-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8R,9S)-11-[(2-amino-3-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 169416355 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (1R,8R,9S)-11-[(2-amino-3-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(Cc3cccnc3N)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C20H27N5O/c1-23(2)13-18-16-9-15(17-6-3-7-19(26)25(17)18)11-24(12-16)10-14-5-4-8-22-20(14)21/h3-8,15-16,18H,9-13H2,1-2H3,(H2,21,22)/t15-,16+,18+/m1/s1 |
| InChIKey | AFASOZVNGOJKMB-RYRKJORJSA-N |
| XLogP | 1.55 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |