C26H36N4O6 — CID 171339663
acetic acid;(1R,8R,9S)-11-[(2R)-2-amino-2-phenylacetyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 171339663) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is acetic acid;(1R,8R,9S)-11-[(2R)-2-amino-2-phenylacetyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | acetic acid;(1R,8R,9S)-11-[(2R)-2-amino-2-phenylacetyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 171339663 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | acetic acid;(1R,8R,9S)-11-[(2R)-2-amino-2-phenylacetyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CC(=O)O.CC(=O)O.CN(C)C[C@H]1[C@H]2C[C@H](CN(C(=O)[C@H](N)c3ccccc3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C22H28N4O2.2C2H4O2/c1-24(2)14-19-17-11-16(18-9-6-10-20(27)26(18)19)12-25(13-17)22(28)21(23)15-7-4-3-5-8-15;2*1-2(3)4/h3-10,16-17,19,21H,11-14,23H2,1-2H3;2*1H3,(H,3,4)/t16-,17+,19+,21-;;/m1../s1 |
| InChIKey | QHSTZPRMLPFGPN-FXZLKAPNSA-N |
| XLogP | 1.78 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |