C22H22N4O3 — CID 169416693
N-[[(1R,8R,9S)-11-(2-cyanobenzoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide (PubChem CID 169416693) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[[(1R,8R,9S)-11-(2-cyanobenzoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide.
| Compound Name | N-[[(1R,8R,9S)-11-(2-cyanobenzoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide |
|---|---|
| PubChem CID | 169416693 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[[(1R,8R,9S)-11-(2-cyanobenzoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccccc3C#N)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C22H22N4O3/c1-14(27)24-11-20-17-9-16(19-7-4-8-21(28)26(19)20)12-25(13-17)22(29)18-6-3-2-5-15(18)10-23/h2-8,16-17,20H,9,11-13H2,1H3,(H,24,27)/t16-,17+,20+/m1/s1 |
| InChIKey | KPGAIFGCRDXRSM-UWVAXJGDSA-N |
| XLogP | 1.66 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |