C23H29N3O3 — CID 169415385
N-[[(1R,8R,9S)-6-oxo-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide (PubChem CID 169415385) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[[(1R,8R,9S)-6-oxo-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide.
| Compound Name | N-[[(1R,8R,9S)-6-oxo-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide |
|---|---|
| PubChem CID | 169415385 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[[(1R,8R,9S)-6-oxo-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(CCOCc3ccccc3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C23H29N3O3/c1-17(27)24-13-22-20-12-19(21-8-5-9-23(28)26(21)22)14-25(15-20)10-11-29-16-18-6-3-2-4-7-18/h2-9,19-20,22H,10-16H2,1H3,(H,24,27)/t19-,20+,22+/m1/s1 |
| InChIKey | ZKKDAPBKNQSQFE-URVUXULASA-N |
| XLogP | 2.16 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|