C21H26ClN3O3 — CID 171708052
(1R,8R,9S)-6-oxo-N-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride (PubChem CID 171708052) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is (1R,8R,9S)-6-oxo-N-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride.
| Compound Name | (1R,8R,9S)-6-oxo-N-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 171708052 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (1R,8R,9S)-6-oxo-N-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCOCc1ccccc1)[C@H]1[C@@H]2CNC[C@@H](C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C21H25N3O3.ClH/c25-19-8-4-7-18-16-11-17(13-22-12-16)20(24(18)19)21(26)23-9-10-27-14-15-5-2-1-3-6-15;/h1-8,16-17,20,22H,9-14H2,(H,23,26);1H/t16-,17+,20-;/m1./s1 |
| InChIKey | ZQMORNHFFYXSQU-VYZBTARASA-N |
| XLogP | 1.85 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|