C18H24N4O5 — CID 171710710
(1R,8R,9S)-11-acetyl-N-(azetidin-3-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid (PubChem CID 171710710) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is (1R,8R,9S)-11-acetyl-N-(azetidin-3-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid.
| Compound Name | (1R,8R,9S)-11-acetyl-N-(azetidin-3-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid |
|---|---|
| PubChem CID | 171710710 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (1R,8R,9S)-11-acetyl-N-(azetidin-3-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid |
| SMILES | CC(=O)N1C[C@H]2C[C@@H](C1)[C@H](C(=O)NC1CNC1)n1c2cccc1=O.O=CO |
| InChI | InChI=1S/C17H22N4O3.CH2O2/c1-10(22)20-8-11-5-12(9-20)16(17(24)19-13-6-18-7-13)21-14(11)3-2-4-15(21)23;2-1-3/h2-4,11-13,16,18H,5-9H2,1H3,(H,19,24);1H,(H,2,3)/t11-,12+,16-;/m1./s1 |
| InChIKey | LNQSWYPXLDCQRQ-FLHZUECGSA-N |
| XLogP | -0.86 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|