C19H18F3N3O4 — CID 171915065
(1R,8R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide (PubChem CID 171915065) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is (1R,8R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide.
| Compound Name | (1R,8R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
|---|---|
| PubChem CID | 171915065 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (1R,8R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccoc3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C19H18F3N3O4/c20-19(21,22)10-23-17(27)16-13-6-12(14-2-1-3-15(26)25(14)16)7-24(8-13)18(28)11-4-5-29-9-11/h1-5,9,12-13,16H,6-8,10H2,(H,23,27)/t12-,13+,16-/m1/s1 |
| InChIKey | ODCZHTLGQABGNT-DVOMOZLQSA-N |
| XLogP | 1.92 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |