C20H25N5O5 — CID 171708893
(1R,8R,9S)-11-acetyl-N-[2-(1H-imidazol-5-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid (PubChem CID 171708893) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is (1R,8R,9S)-11-acetyl-N-[2-(1H-imidazol-5-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid.
| Compound Name | (1R,8R,9S)-11-acetyl-N-[2-(1H-imidazol-5-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid |
|---|---|
| PubChem CID | 171708893 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (1R,8R,9S)-11-acetyl-N-[2-(1H-imidazol-5-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid |
| SMILES | CC(=O)N1C[C@H]2C[C@@H](C1)[C@H](C(=O)NCCc1cnc[nH]1)n1c2cccc1=O.O=CO |
| InChI | InChI=1S/C19H23N5O3.CH2O2/c1-12(25)23-9-13-7-14(10-23)18(24-16(13)3-2-4-17(24)26)19(27)21-6-5-15-8-20-11-22-15;2-1-3/h2-4,8,11,13-14,18H,5-7,9-10H2,1H3,(H,20,22)(H,21,27);1H,(H,2,3)/t13-,14+,18-;/m1./s1 |
| InChIKey | JJXHAYXYARIZRI-BZEWFBLPSA-N |
| XLogP | 0.14 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|