C23H30N4O4 — CID 171711702
N-[[(1R,8R,9S)-11-ethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-pyridin-3-ylpropanamide;formic acid (PubChem CID 171711702) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[[(1R,8R,9S)-11-ethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-pyridin-3-ylpropanamide;formic acid.
| Compound Name | N-[[(1R,8R,9S)-11-ethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-pyridin-3-ylpropanamide;formic acid |
|---|---|
| PubChem CID | 171711702 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[[(1R,8R,9S)-11-ethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-pyridin-3-ylpropanamide;formic acid |
| SMILES | CCN1C[C@H]2C[C@@H](C1)[C@H](CNC(=O)CCc1cccnc1)n1c2cccc1=O.O=CO |
| InChI | InChI=1S/C22H28N4O2.CH2O2/c1-2-25-14-17-11-18(15-25)20(26-19(17)6-3-7-22(26)28)13-24-21(27)9-8-16-5-4-10-23-12-16;2-1-3/h3-7,10,12,17-18,20H,2,8-9,11,13-15H2,1H3,(H,24,27);1H,(H,2,3)/t17-,18+,20+;/m1./s1 |
| InChIKey | QEBZDKVIIGKCJS-GWCBTUNRSA-N |
| XLogP | 1.67 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|