C19H18F3N3O4 — CID 172657501
(1R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide (PubChem CID 172657501) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is (1R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide.
| Compound Name | (1R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide |
|---|---|
| PubChem CID | 172657501 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (1R,9S)-11-(furan-3-carbonyl)-6-oxo-N-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2n(c1=O)C[C@H]1C[C@@H]2CN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C19H18F3N3O4/c20-19(21,22)10-23-16(26)14-1-2-15-13-5-11(7-25(15)18(14)28)6-24(8-13)17(27)12-3-4-29-9-12/h1-4,9,11,13H,5-8,10H2,(H,23,26)/t11-,13+/m0/s1 |
| InChIKey | QFWUSEBZEQMGJB-WCQYABFASA-N |
| XLogP | 1.99 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |