C22H30Cl2N4O3 — CID 172911269
(1R,9S)-5-[[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride (PubChem CID 172911269) has the molecular formula C22H30Cl2N4O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is (1R,9S)-5-[[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride.
| Compound Name | (1R,9S)-5-[[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride |
|---|---|
| PubChem CID | 172911269 |
| Molecular Formula | C22H30Cl2N4O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (1R,9S)-5-[[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccoc1)N1CCCN(Cc2ccc3n(c2=O)C[C@@H]2CNC[C@H]3C2)CC1 |
| InChI | InChI=1S/C22H28N4O3.2ClH/c27-21(18-4-9-29-15-18)25-6-1-5-24(7-8-25)14-17-2-3-20-19-10-16(11-23-12-19)13-26(20)22(17)28;;/h2-4,9,15-16,19,23H,1,5-8,10-14H2;2*1H/t16-,19+;;/m0../s1 |
| InChIKey | RHCZQQJELZVSKA-PAYWWEEGSA-N |
| XLogP | 2.34 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |