C16H25Cl2N3O3S — CID 172896304
(1R,9S)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride (PubChem CID 172896304) has the molecular formula C16H25Cl2N3O3S and a molecular weight of 410.37 g/mol. Its IUPAC name is (1R,9S)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride.
| Compound Name | (1R,9S)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride |
|---|---|
| PubChem CID | 172896304 |
| Molecular Formula | C16H25Cl2N3O3S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (1R,9S)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1c(CN2CCS(=O)(=O)CC2)ccc2n1C[C@@H]1CNC[C@H]2C1 |
| InChI | InChI=1S/C16H23N3O3S.2ClH/c20-16-13(11-18-3-5-23(21,22)6-4-18)1-2-15-14-7-12(8-17-9-14)10-19(15)16;;/h1-2,12,14,17H,3-11H2;2*1H/t12-,14+;;/m0../s1 |
| InChIKey | ZVFUKWAOYJLWRE-CIKMBUIBSA-N |
| XLogP | 0.63 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |