C21H21F2N3O4 — CID 171907220
(1R,8R,9S)-8-(3,3-difluoropyrrolidine-1-carbonyl)-11-(furan-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 171907220) has the molecular formula C21H21F2N3O4 and a molecular weight of 417.41 g/mol. Its IUPAC name is (1R,8R,9S)-8-(3,3-difluoropyrrolidine-1-carbonyl)-11-(furan-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8R,9S)-8-(3,3-difluoropyrrolidine-1-carbonyl)-11-(furan-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 171907220 |
| Molecular Formula | C21H21F2N3O4 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (1R,8R,9S)-8-(3,3-difluoropyrrolidine-1-carbonyl)-11-(furan-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C(c1ccco1)N1C[C@H]2C[C@@H](C1)[C@H](C(=O)N1CCC(F)(F)C1)n1c2cccc1=O |
| InChI | InChI=1S/C21H21F2N3O4/c22-21(23)6-7-24(12-21)20(29)18-14-9-13(15-3-1-5-17(27)26(15)18)10-25(11-14)19(28)16-4-2-8-30-16/h1-5,8,13-14,18H,6-7,9-12H2/t13-,14+,18-/m1/s1 |
| InChIKey | YRKMNABRQXRCCS-QWQRMKEZSA-N |
| XLogP | 2.11 |
| TPSA | 75.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |