C15H20N2O4 — CID 110906971
furan-2-yl-[4-(1-hydroxycyclopentanecarbonyl)piperazin-1-yl]methanone (PubChem CID 110906971) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is furan-2-yl-[4-(1-hydroxycyclopentanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-(1-hydroxycyclopentanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110906971 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | furan-2-yl-[4-(1-hydroxycyclopentanecarbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)C2(O)CCCC2)CC1 |
| InChI | InChI=1S/C15H20N2O4/c18-13(12-4-3-11-21-12)16-7-9-17(10-8-16)14(19)15(20)5-1-2-6-15/h3-4,11,20H,1-2,5-10H2 |
| InChIKey | CGXBEAXVGCBBTB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |