C12H15NO4 — CID 2225250
1,4-dioxa-8-azaspiro[4.5]decan-8-yl(furan-2-yl)methanone (PubChem CID 2225250) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl(furan-2-yl)methanone.
| Compound Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl(furan-2-yl)methanone |
|---|---|
| PubChem CID | 2225250 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H15NO4/c14-11(10-2-1-7-15-10)13-5-3-12(4-6-13)16-8-9-17-12/h1-2,7H,3-6,8-9H2 |
| InChIKey | DYZVPUWXMPWZAG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |