C16H22N2O3 — CID 98260311
(3aR,6aS)-2-(furan-2-carbonyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxamide (PubChem CID 98260311) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3aR,6aS)-2-(furan-2-carbonyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-2-(furan-2-carbonyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 98260311 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (3aR,6aS)-2-(furan-2-carbonyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxamide |
| SMILES | CC(C)NC(=O)C1C[C@@H]2CN(C(=O)c3ccco3)C[C@@H]2C1 |
| InChI | InChI=1S/C16H22N2O3/c1-10(2)17-15(19)11-6-12-8-18(9-13(12)7-11)16(20)14-4-3-5-21-14/h3-5,10-13H,6-9H2,1-2H3,(H,17,19)/t11?,12-,13+ |
| InChIKey | RWKFYWMOJNNLAS-YHWZYXNKSA-N |
| XLogP | 1.90 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |