C12H16N2O2 — CID 121185227
furan-2-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 121185227) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is furan-2-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | furan-2-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 121185227 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | furan-2-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CN1CC2CN(C(=O)c3ccco3)CC2C1 |
| InChI | InChI=1S/C12H16N2O2/c1-13-5-9-7-14(8-10(9)6-13)12(15)11-3-2-4-16-11/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | DCDHXAZOQNCTGB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |