C23H28N4O4 — CID 171387324
N-methyl-5-[[(1R,8R,9S)-6-oxo-8-(pyrrolidine-1-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]furan-2-carboxamide (PubChem CID 171387324) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-methyl-5-[[(1R,8R,9S)-6-oxo-8-(pyrrolidine-1-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]furan-2-carboxamide.
| Compound Name | N-methyl-5-[[(1R,8R,9S)-6-oxo-8-(pyrrolidine-1-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 171387324 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-methyl-5-[[(1R,8R,9S)-6-oxo-8-(pyrrolidine-1-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]furan-2-carboxamide |
| SMILES | CNC(=O)c1ccc(CN2C[C@H]3C[C@@H](C2)[C@H](C(=O)N2CCCC2)n2c3cccc2=O)o1 |
| InChI | InChI=1S/C23H28N4O4/c1-24-22(29)19-8-7-17(31-19)14-25-12-15-11-16(13-25)21(23(30)26-9-2-3-10-26)27-18(15)5-4-6-20(27)28/h4-8,15-16,21H,2-3,9-14H2,1H3,(H,24,29)/t15-,16+,21-/m1/s1 |
| InChIKey | JQWLUOCDSIUUHE-VWKPWSFCSA-N |
| XLogP | 1.58 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |