C26H26N2O3 — CID 164689317
4-[[(1R,8S,9S)-8-benzyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzoic acid (PubChem CID 164689317) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[[(1R,8S,9S)-8-benzyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzoic acid.
| Compound Name | 4-[[(1R,8S,9S)-8-benzyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 164689317 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-[[(1R,8S,9S)-8-benzyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C[C@H]3C[C@@H](C2)[C@H](Cc2ccccc2)n2c3cccc2=O)cc1 |
| InChI | InChI=1S/C26H26N2O3/c29-25-8-4-7-23-21-14-22(24(28(23)25)13-18-5-2-1-3-6-18)17-27(16-21)15-19-9-11-20(12-10-19)26(30)31/h1-12,21-22,24H,13-17H2,(H,30,31)/t21-,22+,24+/m1/s1 |
| InChIKey | NFOSYJOUZILFJR-GPXNEJASSA-N |
| XLogP | 3.95 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |