C22H26F3N3O — CID 169412840
(1R,8R,9S)-8-[(dimethylamino)methyl]-11-[[3-(trifluoromethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 169412840) has the molecular formula C22H26F3N3O and a molecular weight of 405.46 g/mol. Its IUPAC name is (1R,8R,9S)-8-[(dimethylamino)methyl]-11-[[3-(trifluoromethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8R,9S)-8-[(dimethylamino)methyl]-11-[[3-(trifluoromethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 169412840 |
| Molecular Formula | C22H26F3N3O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (1R,8R,9S)-8-[(dimethylamino)methyl]-11-[[3-(trifluoromethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(Cc3cccc(C(F)(F)F)c3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C22H26F3N3O/c1-26(2)14-20-17-10-16(19-7-4-8-21(29)28(19)20)12-27(13-17)11-15-5-3-6-18(9-15)22(23,24)25/h3-9,16-17,20H,10-14H2,1-2H3/t16-,17+,20+/m1/s1 |
| InChIKey | QMCFUCQGJUSRFS-UWVAXJGDSA-N |
| XLogP | 3.59 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |