C27H38N4O5 — CID 171340087
(1R,8R,9S)-8-[(dimethylamino)methyl]-11-(1-phenylpiperidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid (PubChem CID 171340087) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is (1R,8R,9S)-8-[(dimethylamino)methyl]-11-(1-phenylpiperidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid.
| Compound Name | (1R,8R,9S)-8-[(dimethylamino)methyl]-11-(1-phenylpiperidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid |
|---|---|
| PubChem CID | 171340087 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (1R,8R,9S)-8-[(dimethylamino)methyl]-11-(1-phenylpiperidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(C3CCN(c4ccccc4)CC3)C2)c2cccc(=O)n21.O=CO.O=CO |
| InChI | InChI=1S/C25H34N4O.2CH2O2/c1-26(2)18-24-20-15-19(23-9-6-10-25(30)29(23)24)16-28(17-20)22-11-13-27(14-12-22)21-7-4-3-5-8-21;2*2-1-3/h3-10,19-20,22,24H,11-18H2,1-2H3;2*1H,(H,2,3)/t19-,20+,24+;;/m1../s1 |
| InChIKey | JRGOACUGNKXRLT-VMRAKKSRSA-N |
| XLogP | 2.44 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|