C21H26N2O2 — CID 135259792
4-[[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid (PubChem CID 135259792) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 135259792 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-[[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid |
| SMILES | C[C@@H]1CN(Cc2ccc(C(=O)O)cc2)C[C@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-16-12-22(14-19-8-10-20(11-9-19)21(24)25)13-17(2)23(16)15-18-6-4-3-5-7-18/h3-11,16-17H,12-15H2,1-2H3,(H,24,25)/t16-,17+ |
| InChIKey | IAAJJFRUYJFAQM-CALCHBBNSA-N |
| XLogP | 3.48 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |