C33H43N5O2 — CID 144920782
4-[[4-[[3-[(4-benzylpiperazin-1-yl)methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 144920782) has the molecular formula C33H43N5O2 and a molecular weight of 541.74 g/mol. Its IUPAC name is 4-[[4-[[3-[(4-benzylpiperazin-1-yl)methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[4-[[3-[(4-benzylpiperazin-1-yl)methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 144920782 |
| Molecular Formula | C33H43N5O2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | 4-[[4-[[3-[(4-benzylpiperazin-1-yl)methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NO)cc2)CC(C)N1Cc1cccc(CN2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C33H43N5O2/c1-26-20-37(23-29-11-13-32(14-12-29)33(39)34-40)21-27(2)38(26)25-31-10-6-9-30(19-31)24-36-17-15-35(16-18-36)22-28-7-4-3-5-8-28/h3-14,19,26-27,40H,15-18,20-25H2,1-2H3,(H,34,39) |
| InChIKey | LRFMROJMZUWBPD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|