C28H38F3N5O2 — CID 118367172
4-[[(3S,5R)-3,5-dimethyl-4-[[3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 118367172) has the molecular formula C28H38F3N5O2 and a molecular weight of 533.64 g/mol. Its IUPAC name is 4-[[(3S,5R)-3,5-dimethyl-4-[[3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(3S,5R)-3,5-dimethyl-4-[[3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 118367172 |
| Molecular Formula | C28H38F3N5O2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | 4-[[(3S,5R)-3,5-dimethyl-4-[[3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | C[C@@H]1CN(Cc2ccc(C(=O)NO)cc2)C[C@H](C)N1Cc1cccc(CN2CCN(CC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C28H38F3N5O2/c1-21-15-35(17-23-6-8-26(9-7-23)27(37)32-38)16-22(2)36(21)19-25-5-3-4-24(14-25)18-33-10-12-34(13-11-33)20-28(29,30)31/h3-9,14,21-22,38H,10-13,15-20H2,1-2H3,(H,32,37)/t21-,22+ |
| InChIKey | ZFNPKKWAFPMMKK-SZPZYZBQSA-N |
| XLogP | 3.58 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|