C18H26F3N3O2 — CID 135269852
4-[[3,5-dimethyl-4-(4,4,4-trifluorobutyl)piperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 135269852) has the molecular formula C18H26F3N3O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 4-[[3,5-dimethyl-4-(4,4,4-trifluorobutyl)piperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3,5-dimethyl-4-(4,4,4-trifluorobutyl)piperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135269852 |
| Molecular Formula | C18H26F3N3O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[[3,5-dimethyl-4-(4,4,4-trifluorobutyl)piperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NO)cc2)CC(C)N1CCCC(F)(F)F |
| InChI | InChI=1S/C18H26F3N3O2/c1-13-10-23(11-14(2)24(13)9-3-8-18(19,20)21)12-15-4-6-16(7-5-15)17(25)22-26/h4-7,13-14,26H,3,8-12H2,1-2H3,(H,22,25) |
| InChIKey | DLZXLHAUMXPNKG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|