C28H35F3N4O2 — CID 135269730
4-[[3,5-dimethyl-4-[[2-[1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 135269730) has the molecular formula C28H35F3N4O2 and a molecular weight of 516.61 g/mol. Its IUPAC name is 4-[[3,5-dimethyl-4-[[2-[1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3,5-dimethyl-4-[[2-[1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135269730 |
| Molecular Formula | C28H35F3N4O2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 4-[[3,5-dimethyl-4-[[2-[1-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NO)cc2)CC(C)N1Cc1ccccc1C1=CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C28H35F3N4O2/c1-20-15-34(17-22-7-9-24(10-8-22)27(36)32-37)16-21(2)35(20)18-25-5-3-4-6-26(25)23-11-13-33(14-12-23)19-28(29,30)31/h3-11,20-21,37H,12-19H2,1-2H3,(H,32,36) |
| InChIKey | QOHHRLBMBFAZMX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|