C26H36N4O3 — CID 118367258
4-[[(3R,5S)-3,5-dimethyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 118367258) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-[[(3R,5S)-3,5-dimethyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(3R,5S)-3,5-dimethyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 118367258 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 4-[[(3R,5S)-3,5-dimethyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | C[C@@H]1CN(Cc2ccc(C(=O)NO)cc2)C[C@H](C)N1Cc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C26H36N4O3/c1-20-15-29(17-22-7-9-23(10-8-22)26(31)27-32)16-21(2)30(20)19-25-6-4-3-5-24(25)18-28-11-13-33-14-12-28/h3-10,20-21,32H,11-19H2,1-2H3,(H,27,31)/t20-,21+ |
| InChIKey | PEYCHHLSFXKPQJ-OYRHEFFESA-N |
| XLogP | 2.73 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|