C26H36N4O4 — CID 135269511
4-[[3,5-dimethyl-4-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N,2-dihydroxybenzamide (PubChem CID 135269511) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-[[3,5-dimethyl-4-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N,2-dihydroxybenzamide.
| Compound Name | 4-[[3,5-dimethyl-4-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N,2-dihydroxybenzamide |
|---|---|
| PubChem CID | 135269511 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 4-[[3,5-dimethyl-4-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]-N,2-dihydroxybenzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NO)c(O)c2)CC(C)N1Cc1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C26H36N4O4/c1-19-14-29(17-23-6-7-24(25(31)13-23)26(32)27-33)15-20(2)30(19)18-22-5-3-4-21(12-22)16-28-8-10-34-11-9-28/h3-7,12-13,19-20,31,33H,8-11,14-18H2,1-2H3,(H,27,32) |
| InChIKey | MCKYOUDQYYPWLN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|