C30H44FN5O2 — CID 135269716
4-[[4-[[3-[[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 135269716) has the molecular formula C30H44FN5O2 and a molecular weight of 525.71 g/mol. Its IUPAC name is 4-[[4-[[3-[[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[4-[[3-[[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135269716 |
| Molecular Formula | C30H44FN5O2 |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.35 |
| IUPAC Name | 4-[[4-[[3-[[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]methyl]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NO)cc2)CC(C)N1Cc1cccc(CN2CCN(CC(C)(C)F)CC2)c1 |
| InChI | InChI=1S/C30H44FN5O2/c1-23-17-35(19-25-8-10-28(11-9-25)29(37)32-38)18-24(2)36(23)21-27-7-5-6-26(16-27)20-33-12-14-34(15-13-33)22-30(3,4)31/h5-11,16,23-24,38H,12-15,17-22H2,1-4H3,(H,32,37) |
| InChIKey | NZPUIDOYUMMAGI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|