C31H45FN4O3 — CID 135269686
4-[[4-[[3-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 135269686) has the molecular formula C31H45FN4O3 and a molecular weight of 540.72 g/mol. Its IUPAC name is 4-[[4-[[3-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[4-[[3-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135269686 |
| Molecular Formula | C31H45FN4O3 |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | 4-[[4-[[3-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]methyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NO)cc2)CC(C)N1Cc1cccc(OCC2CCN(CC(C)(C)F)CC2)c1 |
| InChI | InChI=1S/C31H45FN4O3/c1-23-17-35(19-25-8-10-28(11-9-25)30(37)33-38)18-24(2)36(23)20-27-6-5-7-29(16-27)39-21-26-12-14-34(15-13-26)22-31(3,4)32/h5-11,16,23-24,26,38H,12-15,17-22H2,1-4H3,(H,33,37) |
| InChIKey | XLVCBVGVQZJRED-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|