C29H41N5O3 — CID 118367285
4-[[(3R,5S)-3,5-dimethyl-4-[3-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]piperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 118367285) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is 4-[[(3R,5S)-3,5-dimethyl-4-[3-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]piperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(3R,5S)-3,5-dimethyl-4-[3-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 118367285 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 4-[[(3R,5S)-3,5-dimethyl-4-[3-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]piperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC(C)N1CCN(Cc2cccc(C(=O)N3[C@H](C)CN(Cc4ccc(C(=O)NO)cc4)C[C@@H]3C)c2)CC1 |
| InChI | InChI=1S/C29H41N5O3/c1-21(2)33-14-12-31(13-15-33)20-25-6-5-7-27(16-25)29(36)34-22(3)17-32(18-23(34)4)19-24-8-10-26(11-9-24)28(35)30-37/h5-11,16,21-23,37H,12-15,17-20H2,1-4H3,(H,30,35)/t22-,23+ |
| InChIKey | YVHSLJXOWZPWAE-ZRZAMGCNSA-N |
| XLogP | 3.07 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|