C25H27N3O4 — CID 135269531
4-[[4-[3-(furan-2-yl)benzoyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 135269531) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[[4-[3-(furan-2-yl)benzoyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[4-[3-(furan-2-yl)benzoyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135269531 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[[4-[3-(furan-2-yl)benzoyl]-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NO)cc2)CC(C)N1C(=O)c1cccc(-c2ccco2)c1 |
| InChI | InChI=1S/C25H27N3O4/c1-17-14-27(16-19-8-10-20(11-9-19)24(29)26-31)15-18(2)28(17)25(30)22-6-3-5-21(13-22)23-7-4-12-32-23/h3-13,17-18,31H,14-16H2,1-2H3,(H,26,29) |
| InChIKey | WZRAXFXZMZTJPU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|