C21H24ClN3O3 — CID 118367328
4-[[(3S,5R)-4-(2-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 118367328) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 4-[[(3S,5R)-4-(2-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(3S,5R)-4-(2-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 118367328 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-[[(3S,5R)-4-(2-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | C[C@@H]1CN(Cc2ccc(C(=O)NO)cc2)C[C@H](C)N1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H24ClN3O3/c1-14-11-24(13-16-7-9-17(10-8-16)20(26)23-28)12-15(2)25(14)21(27)18-5-3-4-6-19(18)22/h3-10,14-15,28H,11-13H2,1-2H3,(H,23,26)/t14-,15+ |
| InChIKey | XLMISUQTVRWGRN-GASCZTMLSA-N |
| XLogP | 3.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|