C28H38N4O2 — CID 118367521
(E)-3-[4-[[(2S,6R)-2,6-dimethyl-4-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 118367521) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is (E)-3-[4-[[(2S,6R)-2,6-dimethyl-4-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[(2S,6R)-2,6-dimethyl-4-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 118367521 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (E)-3-[4-[[(2S,6R)-2,6-dimethyl-4-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | C[C@@H]1CN(Cc2cccc(CN3CCCC3)c2)C[C@H](C)N1Cc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C28H38N4O2/c1-22-17-31(20-27-7-5-6-26(16-27)19-30-14-3-4-15-30)18-23(2)32(22)21-25-10-8-24(9-11-25)12-13-28(33)29-34/h5-13,16,22-23,34H,3-4,14-15,17-21H2,1-2H3,(H,29,33)/b13-12+/t22-,23+ |
| InChIKey | NUOJJMRLZFZNRN-HJUXLZGGSA-N |
| XLogP | 3.90 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|