C18H28N2O2 — CID 135259883
4-[[(3R,5S)-4-butyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid (PubChem CID 135259883) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 4-[[(3R,5S)-4-butyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3R,5S)-4-butyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 135259883 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 4-[[(3R,5S)-4-butyl-3,5-dimethylpiperazin-1-yl]methyl]benzoic acid |
| SMILES | CCCCN1[C@H](C)CN(Cc2ccc(C(=O)O)cc2)C[C@@H]1C |
| InChI | InChI=1S/C18H28N2O2/c1-4-5-10-20-14(2)11-19(12-15(20)3)13-16-6-8-17(9-7-16)18(21)22/h6-9,14-15H,4-5,10-13H2,1-3H3,(H,21,22)/t14-,15+ |
| InChIKey | OKPKQGBECBMCOX-GASCZTMLSA-N |
| XLogP | 3.08 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |