C26H32N4O4 — CID 171317339
(1R,8S,9S)-11-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid (PubChem CID 171317339) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is (1R,8S,9S)-11-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid.
| Compound Name | (1R,8S,9S)-11-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid |
|---|---|
| PubChem CID | 171317339 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (1R,8S,9S)-11-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;formic acid |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(Cc4c(C)n[nH]c4C)C3)c3cccc(=O)n32)c1.O=CO |
| InChI | InChI=1S/C25H30N4O2.CH2O2/c1-16-22(17(2)27-26-16)15-28-13-19-12-20(14-28)24(29-23(19)8-5-9-25(29)30)11-18-6-4-7-21(10-18)31-3;2-1-3/h4-10,19-20,24H,11-15H2,1-3H3,(H,26,27);1H,(H,2,3)/t19-,20+,24+;/m1./s1 |
| InChIKey | AJWUDEDBEOZZTL-ZQXMWMASSA-N |
| XLogP | 3.30 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|