C23H25N3O3S — CID 171908245
(1R,8R,9S)-11-(furan-2-ylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide (PubChem CID 171908245) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is (1R,8R,9S)-11-(furan-2-ylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide.
| Compound Name | (1R,8R,9S)-11-(furan-2-ylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
|---|---|
| PubChem CID | 171908245 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (1R,8R,9S)-11-(furan-2-ylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
| SMILES | Cc1ccsc1CNC(=O)[C@H]1[C@H]2C[C@H](CN(Cc3ccco3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C23H25N3O3S/c1-15-7-9-30-20(15)11-24-23(28)22-17-10-16(19-5-2-6-21(27)26(19)22)12-25(13-17)14-18-4-3-8-29-18/h2-9,16-17,22H,10-14H2,1H3,(H,24,28)/t16-,17+,22-/m1/s1 |
| InChIKey | AOBMOJKSTWXRCV-HYFFOGBASA-N |
| XLogP | 3.29 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |