C22H26N6O3 — CID 171914394
(1R,8R,9S)-11-(furan-2-ylmethyl)-N-[2-(4-methyltriazol-1-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide (PubChem CID 171914394) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is (1R,8R,9S)-11-(furan-2-ylmethyl)-N-[2-(4-methyltriazol-1-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide.
| Compound Name | (1R,8R,9S)-11-(furan-2-ylmethyl)-N-[2-(4-methyltriazol-1-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
|---|---|
| PubChem CID | 171914394 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (1R,8R,9S)-11-(furan-2-ylmethyl)-N-[2-(4-methyltriazol-1-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
| SMILES | Cc1cn(CCNC(=O)[C@H]2[C@H]3C[C@H](CN(Cc4ccco4)C3)c3cccc(=O)n32)nn1 |
| InChI | InChI=1S/C22H26N6O3/c1-15-11-27(25-24-15)8-7-23-22(30)21-17-10-16(19-5-2-6-20(29)28(19)21)12-26(13-17)14-18-4-3-9-31-18/h2-6,9,11,16-17,21H,7-8,10,12-14H2,1H3,(H,23,30)/t16-,17+,21-/m1/s1 |
| InChIKey | OJAOVLCMFKPKET-LLGFUMIMSA-N |
| XLogP | 1.32 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |