C24H30FN3O4 — CID 171322756
(1R,8S,9S)-N-(4-fluorophenyl)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide;formic acid (PubChem CID 171322756) has the molecular formula C24H30FN3O4 and a molecular weight of 443.52 g/mol. Its IUPAC name is (1R,8S,9S)-N-(4-fluorophenyl)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide;formic acid.
| Compound Name | (1R,8S,9S)-N-(4-fluorophenyl)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide;formic acid |
|---|---|
| PubChem CID | 171322756 |
| Molecular Formula | C24H30FN3O4 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (1R,8S,9S)-N-(4-fluorophenyl)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide;formic acid |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(C(=O)Nc3ccc(F)cc3)C2)c2cccc(=O)n21.O=CO |
| InChI | InChI=1S/C23H28FN3O2.CH2O2/c1-15(2)6-11-21-17-12-16(20-4-3-5-22(28)27(20)21)13-26(14-17)23(29)25-19-9-7-18(24)8-10-19;2-1-3/h3-5,7-10,15-17,21H,6,11-14H2,1-2H3,(H,25,29);1H,(H,2,3)/t16-,17+,21+;/m1./s1 |
| InChIKey | BXYGEROOHKLOBE-POKLFOKASA-N |
| XLogP | 4.32 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|