C25H35N3O4 — CID 166598571
formic acid;(1R,8S,9S)-8-(3-methylbutyl)-11-(1,2,5-trimethylpyrrole-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 166598571) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is formic acid;(1R,8S,9S)-8-(3-methylbutyl)-11-(1,2,5-trimethylpyrrole-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | formic acid;(1R,8S,9S)-8-(3-methylbutyl)-11-(1,2,5-trimethylpyrrole-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 166598571 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | formic acid;(1R,8S,9S)-8-(3-methylbutyl)-11-(1,2,5-trimethylpyrrole-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1cc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CCC(C)C)n2c3cccc2=O)c(C)n1C.O=CO |
| InChI | InChI=1S/C24H33N3O2.CH2O2/c1-15(2)9-10-22-19-12-18(21-7-6-8-23(28)27(21)22)13-26(14-19)24(29)20-11-16(3)25(5)17(20)4;2-1-3/h6-8,11,15,18-19,22H,9-10,12-14H2,1-5H3;1H,(H,2,3)/t18-,19+,22+;/m1./s1 |
| InChIKey | PZBANXYPSMDFKV-VODWKBETSA-N |
| XLogP | 3.74 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|