C18H24N4O2 — CID 120930618
(3R,4S)-4-(1-methylpyrazol-4-yl)-N-(2-phenylmethoxyethyl)pyrrolidine-3-carboxamide (PubChem CID 120930618) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (3R,4S)-4-(1-methylpyrazol-4-yl)-N-(2-phenylmethoxyethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-4-(1-methylpyrazol-4-yl)-N-(2-phenylmethoxyethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120930618 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3R,4S)-4-(1-methylpyrazol-4-yl)-N-(2-phenylmethoxyethyl)pyrrolidine-3-carboxamide |
| SMILES | Cn1cc([C@H]2CNC[C@@H]2C(=O)NCCOCc2ccccc2)cn1 |
| InChI | InChI=1S/C18H24N4O2/c1-22-12-15(9-21-22)16-10-19-11-17(16)18(23)20-7-8-24-13-14-5-3-2-4-6-14/h2-6,9,12,16-17,19H,7-8,10-11,13H2,1H3,(H,20,23)/t16-,17+/m1/s1 |
| InChIKey | YDADYCZQRUUJIY-SJORKVTESA-N |
| XLogP | 1.06 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|