C19H26N4O2 — CID 120927468
(3R,4S)-N-[2-(3,5-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 120927468) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3R,4S)-N-[2-(3,5-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[2-(3,5-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120927468 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (3R,4S)-N-[2-(3,5-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)[C@H]2CNC[C@@H]2c2cnn(C)c2)c1 |
| InChI | InChI=1S/C19H26N4O2/c1-13-6-14(2)8-16(7-13)25-5-4-21-19(24)18-11-20-10-17(18)15-9-22-23(3)12-15/h6-9,12,17-18,20H,4-5,10-11H2,1-3H3,(H,21,24)/t17-,18+/m1/s1 |
| InChIKey | UWENUOGWYFMZFK-MSOLQXFVSA-N |
| XLogP | 1.54 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|