C19H27ClN4O2 — CID 120925817
(3R,4S)-N-[2-(2,6-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120925817) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is (3R,4S)-N-[2-(2,6-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,4S)-N-[2-(2,6-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120925817 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (3R,4S)-N-[2-(2,6-dimethylphenoxy)ethyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cc1cccc(C)c1OCCNC(=O)[C@H]1CNC[C@@H]1c1cnn(C)c1.Cl |
| InChI | InChI=1S/C19H26N4O2.ClH/c1-13-5-4-6-14(2)18(13)25-8-7-21-19(24)17-11-20-10-16(17)15-9-22-23(3)12-15;/h4-6,9,12,16-17,20H,7-8,10-11H2,1-3H3,(H,21,24);1H/t16-,17+;/m1./s1 |
| InChIKey | SXNOZZQFQBJVHW-PPPUBMIESA-N |
| XLogP | 1.96 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|