C24H25ClN4O4 — CID 171710802
N-[[(1R,8R,9S)-11-(6-chloroquinolin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide;formic acid (PubChem CID 171710802) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is N-[[(1R,8R,9S)-11-(6-chloroquinolin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide;formic acid.
| Compound Name | N-[[(1R,8R,9S)-11-(6-chloroquinolin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide;formic acid |
|---|---|
| PubChem CID | 171710802 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[[(1R,8R,9S)-11-(6-chloroquinolin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide;formic acid |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(c3ccnc4ccc(Cl)cc34)C2)c2cccc(=O)n21.O=CO |
| InChI | InChI=1S/C23H23ClN4O2.CH2O2/c1-14(29)26-11-22-16-9-15(20-3-2-4-23(30)28(20)22)12-27(13-16)21-7-8-25-19-6-5-17(24)10-18(19)21;2-1-3/h2-8,10,15-16,22H,9,11-13H2,1H3,(H,26,29);1H,(H,2,3)/t15-,16+,22+;/m1./s1 |
| InChIKey | QWUBVEBVJKNIQJ-QJMBPBJNSA-N |
| XLogP | 3.05 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|