C21H26N4O3S — CID 169411366
2-[(1R,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 169411366) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[(1R,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(1R,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 169411366 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[(1R,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(CC(=O)NCc3cccs3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C21H26N4O3S/c1-14(26)22-10-19-16-8-15(18-5-2-6-21(28)25(18)19)11-24(12-16)13-20(27)23-9-17-4-3-7-29-17/h2-7,15-16,19H,8-13H2,1H3,(H,22,26)(H,23,27)/t15-,16+,19+/m1/s1 |
| InChIKey | NFUSNCLKRJRYFP-GJYPPUQNSA-N |
| XLogP | 1.32 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |