C17H25N3O3S — CID 172656051
2-[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 172656051) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 172656051 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(CC(=O)NCc3cccs3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C17H25N3O3S/c1-11(21)19-15-5-12-8-20(9-13(12)6-16(15)22)10-17(23)18-7-14-3-2-4-24-14/h2-4,12-13,15-16,22H,5-10H2,1H3,(H,18,23)(H,19,21)/t12-,13+,15-,16-/m1/s1 |
| InChIKey | MDLIFNXBYJAWHD-OCVGTWLNSA-N |
| XLogP | 0.57 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |