C20H25ClN4O — CID 169411919
(1R,8R,9S)-11-[(5-chloro-2-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 169411919) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is (1R,8R,9S)-11-[(5-chloro-2-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8R,9S)-11-[(5-chloro-2-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 169411919 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (1R,8R,9S)-11-[(5-chloro-2-pyridinyl)methyl]-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(Cc3ccc(Cl)cn3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C20H25ClN4O/c1-23(2)13-19-15-8-14(18-4-3-5-20(26)25(18)19)10-24(11-15)12-17-7-6-16(21)9-22-17/h3-7,9,14-15,19H,8,10-13H2,1-2H3/t14-,15+,19+/m1/s1 |
| InChIKey | YAHBBTNZGKTEEO-VCBZYWHSSA-N |
| XLogP | 2.62 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |